Introduction：Basic information about CAS 3416-57-7|N-Acetonylphthalimide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Acetonylphthalimide |
|---|
| CAS Number | 3416-57-7 | Molecular Weight | 203.194 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 341.1±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9NO3 | Melting Point | 123°C |
|---|
| MSDS | / | Flash Point | 157.1±15.5 °C |
|---|
Names
| Name | 2-(2-oxopropyl)isoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 341.1±25.0 °C at 760 mmHg |
|---|
| Melting Point | 123°C |
|---|
| Molecular Formula | C11H9NO3 |
|---|
| Molecular Weight | 203.194 |
|---|
| Flash Point | 157.1±15.5 °C |
|---|
| Exact Mass | 203.058243 |
|---|
| PSA | 54.45000 |
|---|
| LogP | 1.32 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | STMRGLKPBJVVEG-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)CN1C(=O)c2ccccc2C1=O |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2925190090 |
|---|
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 1H-Isoindole-1,3(2H)-dione,2-(2-oxopropyl) |
| 1H-Isoindole-1,3(2H)-dione, 2-(2-oxopropyl)- |
| PhthaliMidoacetone |
| MFCD00088346 |
| N-Acetonylphthalimide |
| 2-(2-oxopropyl)isoindoline-1,3-dione |
| 2-(2-Oxopropyl)-1H-isoindole-1,3(2H)-dione |
| 1-(N-Phthalimidyl)-2-propanone |
| Phthalimide, N-acetonyl- |
| 1-N-phthalimidopropan-2-one |
| N-(2-oxopropane)-phthalimide |
| 2-(2-Oxo-propyl)-isoindole-1,3-dione |
| N-(2-oxopropyl)-phthalimide |
