Introduction:Basic information about CAS 47355-10-2|Boc-Trp(For)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-Trp(For)-OH |
|---|
| CAS Number | 47355-10-2 | Molecular Weight | 332.351 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C17H20N2O5 | Melting Point | 100ºC |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | (2S)-3-(1-formylindol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Melting Point | 100ºC |
|---|
| Molecular Formula | C17H20N2O5 |
|---|
| Molecular Weight | 332.351 |
|---|
| Exact Mass | 332.137207 |
|---|
| PSA | 97.63000 |
|---|
| LogP | 3.06 |
|---|
| Index of Refraction | 1.580 |
|---|
| InChIKey | IHXHBYFWSOYYTR-ZDUSSCGKSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(Cc1cn(C=O)c2ccccc12)C(=O)O |
|---|
| Storage condition | −20°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Safety Phrases | 24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Nα-Boc-N1-formyl-L-tryptophan |
| MFCD00065992 |
| Boc-Trp(N-CHO)-OH |
| Nalpha-(tert-Butoxycarbonyl)-N1-formyl-L-tryptophan |
| L-Tryptophan, N-[(1,1-dimethylethoxy)carbonyl]-1-formyl- |
| N-alpha-BOC-N(in)-Formyl-L-tryptophan |
| Boc-Trp(For) |
| Boc-W(N-CHO)-OH |
| Boc-Trp(For)-OH |
| Boc-L-Trp(For)-OH |
| N-(tert-Butoxycarbonyl)-N'-formyl-L-tryptophan |
| Boc-Trp(CHO)-OH |
| 1-Formyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-tryptophan |
| Nalpha-Boc-N(in)-formyl-L-tryptophan |
| N-(tert-Butoxycarbonyl)-1-formyl-L-tryptophan |
| Nα-(tert-Butoxycarbonyl)-N1-forMyl-L-tryptophan |
| BOC-Trp(CHO) |
| (S)-2-((tert-Butoxycarbonyl)amino)-3-(1-formyl-1H-indol-3-yl)propanoic acid |