Introduction：Basic information about CAS 18514-46-0|Trt-Gly-OEt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Trt-Gly-OEt |
|---|
| CAS Number | 18514-46-0 | Molecular Weight | 345.43400 |
|---|
| Density | 1.11g/cm3 | Boiling Point | 459.1ºC at 760mmHg |
|---|
| Molecular Formula | C23H23NO2 | Melting Point | 110-112°C |
|---|
| MSDS | / | Flash Point | 231.4ºC |
|---|
Names
| Name | ethyl 2-(tritylamino)acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.11g/cm3 |
|---|
| Boiling Point | 459.1ºC at 760mmHg |
|---|
| Melting Point | 110-112°C |
|---|
| Molecular Formula | C23H23NO2 |
|---|
| Molecular Weight | 345.43400 |
|---|
| Flash Point | 231.4ºC |
|---|
| Exact Mass | 345.17300 |
|---|
| PSA | 38.33000 |
|---|
| LogP | 4.52210 |
|---|
| Vapour Pressure | 1.31E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | CAFYNMFIEFNYRA-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | T+ |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| HS Code | 2922499990 |
|---|
Customs
| HS Code | 2922499990 |
|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| N-Trityl-glycinethylester |
| N-TRITYLGLYCINE ETHYL ESTER |
| ethyl 2-(tritylamino)ethanoate |
| ethyl 2-[(triphenylmethyl)amino]acetate |
| ethyl-N-(triphenylmethyl)glycinate |
| N-trityl-glycine ethyl ester |
| MFCD00026893 |
| N-(triphenylmethyl)-glycine,ethyl ester |
| ethyl N-triphenylmethyl glycine ester |
| ethyl n-tritylglycinate |
| N-Trityl-glycin-aethylester |
