Introduction:Basic information about CAS 79822-46-1|4-tert-Butyl-3-methoxybenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-tert-Butyl-3-methoxybenzoic acid |
|---|
| CAS Number | 79822-46-1 | Molecular Weight | 208.254 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 334.7±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H16O3 | Melting Point | 150-152ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 125.2±19.4 °C |
|---|
Names
| Name | 4-tert-Butyl-3-methoxybenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 334.7±35.0 °C at 760 mmHg |
|---|
| Melting Point | 150-152ºC |
|---|
| Molecular Formula | C12H16O3 |
|---|
| Molecular Weight | 208.254 |
|---|
| Flash Point | 125.2±19.4 °C |
|---|
| Exact Mass | 208.109940 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.71 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.517 |
|---|
| InChIKey | CSJQLIMNCLFPLZ-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C(=O)O)ccc1C(C)(C)C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-tert-butyl-3-methoxybenzoic acid |
| QVR CO1 DX1&1&1 |
| 3-Methoxy-4-t-Butyl-Benzoicacid |
| 3-Methoxy-4-tert-butylbenzoic acid |
| 3-Methoxy-4-(2-methyl-2-propanyl)benzoic acid |
| 4-tert-Butyl-3-methoxy-benzoesaeure |
| Benzoic acid, 4-(1,1-dimethylethyl)-3-methoxy- |
| 4-t-Butyl-3-methoxybenzoic acid |
| 3-Methoxy-4-t-butylbenzoic acid |
| MFCD06656116 |