Introduction：Basic information about CAS 778-24-5|Diphenyldimethylsilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diphenyldimethylsilane |
|---|
| CAS Number | 778-24-5 | Molecular Weight | 212.362 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 265.9±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H16Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 100.3±13.4 °C |
|---|
Names
| Name | dimethyl(diphenyl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 265.9±13.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H16Si |
|---|
| Molecular Weight | 212.362 |
|---|
| Flash Point | 100.3±13.4 °C |
|---|
| Exact Mass | 212.102127 |
|---|
| LogP | 4.67 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | WJKVFIFBAASZJX-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Diphenyldimethylsilane |
| Dimethyl diphenylsilane |
| Biphenyldimethylsilane |
| Silane,dimethyldiphenyl |
| MFCD00041326 |
| Benzene, 1,1'-(dimethylsilylene)bis- |
| Dimethyl(diphenyl)silane |
| dimethyldiphenylsilane |
