Introduction：Basic information about CAS 97685-00-2|dabsyl-l-tryptophan, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dabsyl-l-tryptophan |
|---|
| CAS Number | 97685-00-2 | Molecular Weight | 491.562 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 766.9±70.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H25N5O4S | Melting Point | 206 °C |
|---|
| MSDS | / | Flash Point | 417.6±35.7 °C |
|---|
Names
| Name | (2S)-2-[[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 766.9±70.0 °C at 760 mmHg |
|---|
| Melting Point | 206 °C |
|---|
| Molecular Formula | C25H25N5O4S |
|---|
| Molecular Weight | 491.562 |
|---|
| Flash Point | 417.6±35.7 °C |
|---|
| Exact Mass | 491.162720 |
|---|
| PSA | 135.60000 |
|---|
| LogP | 5.42 |
|---|
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | SGKGZXUAHWJTIA-DEOSSOPVSA-N |
|---|
| SMILES | CN(C)c1ccc(N=Nc2ccc(S(=O)(=O)NC(Cc3c[nH]c4ccccc34)C(=O)O)cc2)cc1 |
|---|
Synonyms
| L-Tryptophan, N-[[4-[(E)-2-[4-(dimethylamino)phenyl]diazenyl]phenyl]sulfonyl]- |
| Dabsyl-L-tryptophan |
| 4-Dimethylaminoazobenzene-4'-sulfonyl-L-tryptophan |
| Dbs-Trp-OH |
| N-[(4-{(E)-[4-(Dimethylamino)phenyl]diazenyl}phenyl)sulfonyl]-L-tryptophan |
| D1459 |
