Introduction：Basic information about CAS 643-38-9|acridinic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | acridinic acid |
|---|
| CAS Number | 643-38-9 | Molecular Weight | 217.178 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 423.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H7NO4 | Melting Point | 183 °C |
|---|
| MSDS | USA | Flash Point | 210.0±27.3 °C |
|---|
Names
| Name | quinoline-2,3-dicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 423.7±40.0 °C at 760 mmHg |
|---|
| Melting Point | 183 °C |
|---|
| Molecular Formula | C11H7NO4 |
|---|
| Molecular Weight | 217.178 |
|---|
| Flash Point | 210.0±27.3 °C |
|---|
| Exact Mass | 217.037506 |
|---|
| PSA | 87.49000 |
|---|
| LogP | 1.50 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.720 |
|---|
| InChIKey | YHUVMHKAHWKQBI-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc2ccccc2nc1C(=O)O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933499090 |
|---|
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| MFCD00071756 |
| Quinolinedicarboxylic acid |
| Chinolin-2,3-dicarbonsaeure |
| acridic acid |
| Quinoline-2,3-dicarboxylic acid |
| 2,3-DIFLUORO-6-METHOXYBENZYL ALCOHOL |
| Acridinsaeure |
| 2,3-Quinoline dicarboxylic acid |
| 2,3-Quinolinedicarboxylic acid |
| acridinic acid |
| 2,3-Quinolinedecarboxylic acid |
| 2,3-QuinolinedicarboxylicAcid |
