Introduction：Basic information about CAS 18529-09-4|4-Chloro-2-methyl-7-(trifluoromethyl)quinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-2-methyl-7-(trifluoromethyl)quinoline |
|---|
| CAS Number | 18529-09-4 | Molecular Weight | 245.628 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 277.2±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H7ClF3N | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 121.5±25.9 °C |
|---|
| Symbol |
GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 4-chloro-2-methyl-7-(trifluoromethyl)quinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 277.2±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H7ClF3N |
|---|
| Molecular Weight | 245.628 |
|---|
| Flash Point | 121.5±25.9 °C |
|---|
| Exact Mass | 245.021912 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 4.18 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.550 |
|---|
| InChIKey | KQXIMYKBHAMAAM-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Cl)c2ccc(C(F)(F)F)cc2n1 |
|---|
Safety Information
| Symbol |
GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H318 |
|---|
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
|---|
| Hazard Codes | T |
|---|
| Risk Phrases | 25-41 |
|---|
| Safety Phrases | 26-39-45 |
|---|
| RIDADR | UN 2811 6.1 / PGIII |
|---|
| HS Code | 2933499090 |
|---|
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 7-Trifluormethyl-4-chlor-2-methyl-chinolin |
| MFCD00272334 |
| Quinoline, 4-chloro-2-methyl-7-(trifluoromethyl)- |
| 4-Chloro-2-methyl-7-trifluoromethylquinoline |
| 4-Chlor-7-trifluormethylchinaldin |
| 4-Chloro-2-methyl-7-(trifluoromethyl)quinoline |
| 4-chlor-2-methyl-7-trifluormethylchinolin |
