Introduction:Basic information about CAS 475102-13-7|5-Bromo-N-Boc-indol-2-boronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Bromo-N-Boc-indol-2-boronic acid |
|---|
| CAS Number | 475102-13-7 | Molecular Weight | 339.978 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 503.5±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H15BBrNO4 | Melting Point | 93-95ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 258.3±32.9 °C |
|---|
Names
| Name | 1-BOC-5-bromoindole-2-boronic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 503.5±60.0 °C at 760 mmHg |
|---|
| Melting Point | 93-95ºC |
|---|
| Molecular Formula | C13H15BBrNO4 |
|---|
| Molecular Weight | 339.978 |
|---|
| Flash Point | 258.3±32.9 °C |
|---|
| Exact Mass | 339.027740 |
|---|
| PSA | 71.69000 |
|---|
| LogP | 4.37 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.586 |
|---|
| InChIKey | RBYTXZMVOGZESQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)n1c(B(O)O)cc2cc(Br)ccc21 |
|---|
| Storage condition | Keep Cold |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi,Xn |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S22-S26-S36/37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| [5-Bromo-1-(tert-butoxycarbonyl)-1H-indol-2-yl]boronic acid |
| MFCD03788405 |
| 5-Bromo-N-Boc-indol-2-boronic acid |
| (5-Bromo-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-1H-indol-2-yl)boronic acid |
| 5-BROMO-1-(TERT-BUTOXYCARBONYL)-1H-INDOL-2-YLBORONIC ACID |
| [5-Bromo-1-(butoxycarbonyl)-1H-indol-2-yl]boronic acid |
| 1H-Indole-1-carboxylic acid, 2-borono-5-bromo-, 1,1-dimethylethyl ester |
| T56 BNJ BVOX1&1&1 CBQQ GE |
| (5-Bromo-1-(tert-butoxycarbonyl)-1H-indol-2-yl)boronic acid |
| N-Boc-5-bromoindole-2-boronic acid |
| [5-bromo-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| (N-Boc-5-bromo-2-indolyl)boronic acid |
| 1H-Indole-1-carboxylic acid, 2-borono-5-bromo-, butyl ester |