Introduction:Basic information about CAS 18622-23-6|4-Biphenylcarboxylic acid hydrazide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Biphenylcarboxylic acid hydrazide |
|---|
| CAS Number | 18622-23-6 | Molecular Weight | 212.24700 |
|---|
| Density | 1.164 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C13H12N2O | Melting Point | 190-193°C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-phenylbenzohydrazide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.164 g/cm3 |
|---|
| Melting Point | 190-193°C |
|---|
| Molecular Formula | C13H12N2O |
|---|
| Molecular Weight | 212.24700 |
|---|
| Exact Mass | 212.09500 |
|---|
| PSA | 55.12000 |
|---|
| LogP | 3.04830 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | QEUAQXSDDNDOTG-UHFFFAOYSA-N |
|---|
| SMILES | NNC(=O)c1ccc(-c2ccccc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2928000090 |
|---|
Customs
| HS Code | 2928000090 |
|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 4-Phenylbenzoic Hydrazide |
| 1,1'-biphenyl-4-carbohydrazide |
| biphenyl-4-carboxylic hydrazide |
| 4-Phenylbenzhydrazide |
| EINECS 242-451-8 |
| MFCD00017078 |
| 4-Biphenylcarboxylic acid hydrazide |
| 4-Phenylbenzoylhydrazine |
| biphenyl-4-carboxylic acid hydrazide |
| p-Phenyl benzhydrazide |
| 4-phenylbenzoyl hydrazide |
| Biphenyl-4-carbohydrazide |