Introduction:Basic information about CAS 349-96-2|4-Nitrobenzenesulfonyl fluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Nitrobenzenesulfonyl fluoride |
|---|
| CAS Number | 349-96-2 | Molecular Weight | 205.164 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 305.1±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H4FNO4S | Melting Point | 76-80ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 138.3±23.2 °C |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | 4-nitrobenzenesulfonyl fluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 305.1±25.0 °C at 760 mmHg |
|---|
| Melting Point | 76-80ºC |
|---|
| Molecular Formula | C6H4FNO4S |
|---|
| Molecular Weight | 205.164 |
|---|
| Flash Point | 138.3±23.2 °C |
|---|
| Exact Mass | 204.984512 |
|---|
| PSA | 88.34000 |
|---|
| LogP | 2.48 |
|---|
| Appearance of Characters | Crystalline Powder | Yellow |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | HRLAPUHJWRZEIC-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)F)cc1 |
|---|
| Storage condition | 2~8℃ |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338 |
|---|
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 45-36/37/39-26 |
|---|
| RIDADR | UN 1759 |
|---|
| Packaging Group | III |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-Nitro-benzolsulfonylfluorid |
| 4-Nitrobenzenesulfonyl fluoride |
| Benzenesulfonyl fluoride, 4-nitro- |
| p-NO2PhSO2F |
| 4-nitro-benzenesulfonyl fluoride |
| HRLAPUHJWRZEIC-UHFFFAOYSA |
| 4-Nitrobenzene-1-sulfonyl fluoride |
| p-Nitrobenzenesulfonyl fluoride |
| para-Nitrobenzenesulfonyl fluoride |
| PNBSF |