Introduction：Basic information about CAS 5800-50-0|phenylthiohydantoin-delta-threonine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | phenylthiohydantoin-delta-threonine |
|---|
| CAS Number | 5800-50-0 | Molecular Weight | 218.27500 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 322.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10N2OS | Melting Point | 234.0 to 238.0 °C |
|---|
| MSDS | / | Flash Point | 148.7ºC |
|---|
Names
| Name | (5E)-5-ethylidene-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 322.3ºC at 760 mmHg |
|---|
| Melting Point | 234.0 to 238.0 °C |
|---|
| Molecular Formula | C11H10N2OS |
|---|
| Molecular Weight | 218.27500 |
|---|
| Flash Point | 148.7ºC |
|---|
| Exact Mass | 218.05100 |
|---|
| PSA | 64.43000 |
|---|
| LogP | 2.20530 |
|---|
| Index of Refraction | 1.688 |
|---|
| InChIKey | SXYSWGDIVRMEDE-UHFFFAOYSA-N |
|---|
| SMILES | CC=C1NC(=S)N(c2ccccc2)C1=O |
|---|
Synonyms
| P0370 |
| 5-Ethylidene-3-phenyl-2-thiohydantoin |
| 5-Aethyliden-3-phenyl-2-thioxo-imidazolidin-4-on |
| 5-ethylidene-3-phenyl-2-thioxo-imidazolidin-4-one |
