Introduction:Basic information about CAS 58808-59-6|4-(Trifluoroacetyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(Trifluoroacetyl)benzoic acid |
|---|
| CAS Number | 58808-59-6 | Molecular Weight | 218.129 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 313.5±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H5F3O3 | Melting Point | 178 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 143.4±27.9 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-(trifluoroacetyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 313.5±42.0 °C at 760 mmHg |
|---|
| Melting Point | 178 °C |
|---|
| Molecular Formula | C9H5F3O3 |
|---|
| Molecular Weight | 218.129 |
|---|
| Flash Point | 143.4±27.9 °C |
|---|
| Exact Mass | 218.019073 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 2.10 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.494 |
|---|
| InChIKey | WLTZCRCZDLLXQP-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(C(=O)C(F)(F)F)cc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| MFCD00052340 |
| 4-(2,2,2-trifluoroacetyl)benzoic acid |
| Benzoic acid, 4-(2,2,2-trifluoroacetyl)- |
| 4-(Trifluoroacetyl)benzoic acid |