Introduction:Basic information about CAS 58561-09-4|3-BROMO-1-ETHYL-1,4-DIHYDRO[1,3]DIOXOLO[4,5-G]CINNOLIN-4-ONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-BROMO-1-ETHYL-1,4-DIHYDRO[1,3]DIOXOLO[4,5-G]CINNOLIN-4-ONE |
|---|
| CAS Number | 58561-09-4 | Molecular Weight | 297.10500 |
|---|
| Density | 1.83g/cm3 | Boiling Point | 444.8ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9BrN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.8ºC |
|---|
Names
| Name | 3-bromo-1-ethyl-[1,3]dioxolo[4,5-g]cinnolin-4-one |
|---|
Chemical & Physical Properties
| Density | 1.83g/cm3 |
|---|
| Boiling Point | 444.8ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9BrN2O3 |
|---|
| Molecular Weight | 297.10500 |
|---|
| Flash Point | 222.8ºC |
|---|
| Exact Mass | 295.98000 |
|---|
| PSA | 53.35000 |
|---|
| LogP | 1.90760 |
|---|
| Index of Refraction | 1.716 |
|---|
| InChIKey | PEKXZCZTNAVIJC-UHFFFAOYSA-N |
|---|
| SMILES | CCn1nc(Br)c(=O)c2cc3c(cc21)OCO3 |
|---|