Introduction:Basic information about CAS 335-58-0|perfluoro-n-heptyl iodide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | perfluoro-n-heptyl iodide |
|---|
| CAS Number | 335-58-0 | Molecular Weight | 495.95500 |
|---|
| Density | 2,01 g/cm3 | Boiling Point | 137 °C |
|---|
| Molecular Formula | C7F15I | Melting Point | / |
|---|
| MSDS | / | Flash Point | 137-138°C |
|---|
Names
| Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-7-iodoheptane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2,01 g/cm3 |
|---|
| Boiling Point | 137 °C |
|---|
| Molecular Formula | C7F15I |
|---|
| Molecular Weight | 495.95500 |
|---|
| Flash Point | 137-138°C |
|---|
| Exact Mass | 495.88100 |
|---|
| LogP | 5.75300 |
|---|
| Index of Refraction | 1.329 |
|---|
| InChIKey | AHUMDLIBMIYQMU-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2903799090 |
|---|
Customs
| HS Code | 2903799090 |
|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| Perfluoro-n-heptyl iodide |
| 1-iodopentadecafluoroheptane |
| 1-iodoperfluoroheptane |
| 1-iodoperfluoro-n-heptane |
| MFCD00013712 |
| EINECS 206-393-7 |
| Perfluoroheptyl iodide |