Introduction：Basic information about CAS 97-08-5|4-Chloro-3-nitrobenzene-1-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-3-nitrobenzene-1-sulfonyl chloride |
|---|
| CAS Number | 97-08-5 | Molecular Weight | 256.063 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 356.0±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3Cl2NO4S | Melting Point | 59-60 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 169.1±23.7 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 4-Chloro-3-nitrobenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 356.0±27.0 °C at 760 mmHg |
|---|
| Melting Point | 59-60 °C(lit.) |
|---|
| Molecular Formula | C6H3Cl2NO4S |
|---|
| Molecular Weight | 256.063 |
|---|
| Flash Point | 169.1±23.7 °C |
|---|
| Exact Mass | 254.915985 |
|---|
| PSA | 88.34000 |
|---|
| LogP | 2.86 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.600 |
|---|
| InChIKey | SEWNAJIUKSTYOP-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Cl)ccc1Cl |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R14;R29;R34 |
|---|
| Safety Phrases | S26-S27-S28-S36/37/39-S45-S8-S30-S22 |
|---|
| RIDADR | UN 3261 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Yellow Sulfon Chloride |
| WSGR DG CNW |
| 3-nitro-4-chlorosulfonyl chloride |
| 4-Chloro-3-nitrobenzenesulphonyl chloride |
| 4-chloro-3-nitrophenylsulfonyl chloride |
| 4-Chloro-3-Nitrobenzene-1-Sulfonyl Chloride |
| Benzenesulfonyl chloride, 4-chloro-3-nitro- |
| 3-nitro-4-chlorobenzenesulfonyl chloride |
| 4-chloro-3-nitro-benzenesulfonyl chloride |
| 3-nitro-4-chlorobenzene sulfonic acid chloride |
| Benzenesulfonyl chloride,4-chloro-3-nitro |
| 4-Chloro-3-nitrobenzenesulfonyl chloride |
| EINECS 202-558-2 |
| MFCD00007440 |
