Introduction：Basic information about CAS 6358-08-3|2-Amino-4-chloro-6-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Amino-4-chloro-6-nitrophenol |
|---|
| CAS Number | 6358-08-3 | Molecular Weight | 188.568 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 308.3±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H5ClN2O3 | Melting Point | 158-162 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 140.2±27.9 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-Amino-4-chloro-6-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 308.3±42.0 °C at 760 mmHg |
|---|
| Melting Point | 158-162 °C(lit.) |
|---|
| Molecular Formula | C6H5ClN2O3 |
|---|
| Molecular Weight | 188.568 |
|---|
| Flash Point | 140.2±27.9 °C |
|---|
| Exact Mass | 187.998871 |
|---|
| PSA | 92.07000 |
|---|
| LogP | 2.69 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.695 |
|---|
| InChIKey | MHAFRUMLQZZSIN-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(Cl)cc([N+](=O)[O-])c1O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2922299090 |
|---|
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-Amino-4-chloro-6-nitrophenol |
| 6-amino-4-chloro-2-nitrophenol |
| MFCD00035925 |
| 6-Nitro-4-chloro-2-aminophenol |
| 4-chloro-6-nitro-2-aminophenol |
| 2-amino-4-chloro-6-nitro-phenol |
| EINECS 228-761-6 |
| 2,6 DICHLORO-4-METHYL-3-PYRIDINE CARBONITRILE |
| 2-Amino-4-chlor-6-nitro-phenol |
| Phenol, 2-amino-4-chloro-6-nitro- |
| 1-amino-2-hydroxy-3-nitro-5-chlorobenzene |
