Introduction：Basic information about CAS 782504-35-2|4-T-butyl-N-(4-isopropylphenyl)benzenamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-T-butyl-N-(4-isopropylphenyl)benzenamine |
|---|
| CAS Number | 782504-35-2 | Molecular Weight | 267.409 |
|---|
| Density | 1.0±0.0 g/cm3 | Boiling Point | 371.1±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H25N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 181.2±0.0 °C |
|---|
Names
| Name | 4-tert-butyl-phenyl-4'-isopropyl-phenylamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.0 g/cm3 |
|---|
| Boiling Point | 371.1±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H25N |
|---|
| Molecular Weight | 267.409 |
|---|
| Flash Point | 181.2±0.0 °C |
|---|
| Exact Mass | 267.198700 |
|---|
| PSA | 12.03000 |
|---|
| LogP | 6.00 |
|---|
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.561 |
|---|
| InChIKey | QSQSJBUBCKHJFG-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)c1ccc(Nc2ccc(C(C)(C)C)cc2)cc1 |
|---|
Synonyms
| Benzenamine, 4-(1,1-dimethylethyl)-N-[4-(1-methylethyl)phenyl]- |
| 4-t-butyl-N-(4-isopropylphenyl)benzenamine |
| 4-t-butylphenyl-4-isopropylphenyl amine |
| 4-isopropylphenyl-4'-t-butylphenylamine |
| 4-Isopropyl-N-[4-(2-methyl-2-propanyl)phenyl]aniline |
