Introduction：Basic information about CAS 183321-83-7|ErlotinibiMpurityB, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ErlotinibiMpurityB |
|---|
| CAS Number | 183321-83-7 | Molecular Weight | 397.855 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 556.8±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H20ClN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 290.5±30.1 °C |
|---|
Names
| Name | 6-(2-Chloroethoxy)-N-(3-ethynylphenyl)-7-(2-methoxyethoxy)-4-quinazolinamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 556.8±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H20ClN3O3 |
|---|
| Molecular Weight | 397.855 |
|---|
| Flash Point | 290.5±30.1 °C |
|---|
| Exact Mass | 397.119324 |
|---|
| LogP | 3.18 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | DBLVDARHJKFUSK-UHFFFAOYSA-N |
|---|
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OCCOC)c(OCCCl)cc23)c1 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| MFCD25976561 |
| 4-Quinazolinamine, 6-(2-chloroethoxy)-N-(3-ethynylphenyl)-7-(2-methoxyethoxy)- |
| 6-(2-Chloroethoxy)-N-(3-ethynylphenyl)-7-(2-methoxyethoxy)-4-quinazolinamine |
| Erlotinib Impurity 3 |
