Introduction:Basic information about CAS 182211-02-5|Methyloxirane polymer with oxirane, ether with 2,4,7,9-tetramethyl-5-decyne-4,7-diol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyloxirane polymer with oxirane, ether with 2,4,7,9-tetramethyl-5-decyne-4,7-diol (2:1) |
|---|
| CAS Number | 182211-02-5 | Molecular Weight | / |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H26O2.2(C3H6O)x.2(C2H4O)x | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Methyloxirane polymer with oxirane, ether with 2,4,7,9-tetramethyl-5-decyne-4,7-diol (2:1) |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H26O2.2(C3H6O)x.2(C2H4O)x |
|---|