Introduction:Basic information about CAS 71850-06-1|Uridine 5'-monophosphate, monoanhydride with (phosphonomethyl)phosphonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Uridine 5'-monophosphate, monoanhydride with (phosphonomethyl)phosphonic acid |
|---|
| CAS Number | 71850-06-1 | Molecular Weight | 482.17 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H17N2O14P3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Uridine 5'-monophosphate, monoanhydride with (phosphonomethyl)phosphonic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H17N2O14P3 |
|---|
| Molecular Weight | 482.17 |
|---|
| InChIKey | YAMUBYIKSYFVRX-ZOQUXTDFSA-N |
|---|
| SMILES | O=c1ccn(C2OC(COP(=O)(O)OP(=O)(O)CP(=O)(O)O)C(O)C2O)c(=O)[nH]1 |
|---|