Introduction:Basic information about CAS 92246-90-7|Valine, N-benzoyl-, ester with glycolic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Valine, N-benzoyl-, ester with glycolic acid |
|---|
| CAS Number | 92246-90-7 | Molecular Weight | 279.29 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H17NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Valine, N-benzoyl-, ester with glycolic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H17NO5 |
|---|
| Molecular Weight | 279.29 |
|---|
| InChIKey | UXRMFSRKFYMHSW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C(NC(=O)c1ccccc1)C(=O)OCC(=O)O |
|---|