Introduction：Basic information about CAS 799558-94-4|GSK334429 hydrochloride, >=98% (HPLC), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | GSK334429 hydrochloride, >=98% (HPLC) |
|---|
| CAS Number | 799558-94-4 | Molecular Weight | 434.9 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C20H30ClF3N4O | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | GSK334429 hydrochloride, >=98% (HPLC) |
|---|
Chemical & Physical Properties
| Molecular Formula | C20H30ClF3N4O |
|---|
| Molecular Weight | 434.9 |
|---|
| InChIKey | RCZVWLOXPFGZDD-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)N1CCCN(C(=O)C2CCN(c3ccc(C(F)(F)F)nc3)CC2)CC1.Cl |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
