Introduction:Basic information about CAS 77010-42-5|(1R,3R)-3-(2,2-Dibromoethenyl)-2,2-dimethylcyclopropanecarboxylic acid (S)-cyano(3-ph, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1R,3R)-3-(2,2-Dibromoethenyl)-2,2-dimethylcyclopropanecarboxylic acid (S)-cyano(3-phenoxyphenyl)methyl ester mixt. with 5-[[2-(2-butoxyethoxy)ethoxy]methyl]-6-propyl-1,3-benzodioxole |
|---|
| CAS Number | 77010-42-5 | Molecular Weight | 843.6 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C41H49Br2NO8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (1R,3R)-3-(2,2-Dibromoethenyl)-2,2-dimethylcyclopropanecarboxylic acid (S)-cyano(3-phenoxyphenyl)methyl ester mixt. with 5-[[2-(2-butoxyethoxy)ethoxy]methyl]-6-propyl-1,3-benzodioxole |
|---|
Chemical & Physical Properties
| Molecular Formula | C41H49Br2NO8 |
|---|
| Molecular Weight | 843.6 |
|---|
| InChIKey | QPGOPZXISLVRBJ-LLSKDXDJSA-N |
|---|
| SMILES | CC1(C)C(C=C(Br)Br)C1C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1.CCCCOCCOCCOCc1cc2c(cc1CCC)OCO2 |
|---|