Introduction：Basic information about CAS 18032-46-7|Lactic acid, tetraester with silicic acid (H4SiO4), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Lactic acid, tetraester with silicic acid (H4SiO4) |
|---|
| CAS Number | 18032-46-7 | Molecular Weight | 384.36 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H20O12Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Lactic acid, tetraester with silicic acid (H4SiO4) |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H20O12Si |
|---|
| Molecular Weight | 384.36 |
|---|
| InChIKey | OIWAWASLHCGDPG-UHFFFAOYSA-N |
|---|
| SMILES | CC(O[Si](OC(C)C(=O)O)(OC(C)C(=O)O)OC(C)C(=O)O)C(=O)O |
|---|
