Introduction：Basic information about CAS 58653-45-5|1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-, mixt. with 2-(4-thiazolyl)-1H-be, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-, mixt. with 2-(4-thiazolyl)-1H-benzimidazole[(trichloromethyl)thio]- |
|---|
| CAS Number | 58653-45-5 | Molecular Weight | 501.8 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H15Cl3N4O2S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1H-Isoindole-1,3(2H)-dione, 3a,4,7,7a-tetrahydro-2-, mixt. with 2-(4-thiazolyl)-1H-benzimidazole[(trichloromethyl)thio]- |
|---|
Chemical & Physical Properties
| Molecular Formula | C19H15Cl3N4O2S2 |
|---|
| Molecular Weight | 501.8 |
|---|
| InChIKey | RKXHVBSTAJLIBW-UHFFFAOYSA-N |
|---|
| SMILES | O=C1C2CC=CCC2C(=O)N1SC(Cl)(Cl)Cl.c1ccc2[nH]c(-c3cscn3)nc2c1 |
|---|
