Introduction:Basic information about CAS 63146-46-3|Acetic acid, 2-(2,4-dichlorophenoxy)-mixt. with S-ethyl dipropylcarbamothioate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetic acid, 2-(2,4-dichlorophenoxy)-mixt. with S-ethyl dipropylcarbamothioate |
|---|
| CAS Number | 63146-46-3 | Molecular Weight | 410.4 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C17H25Cl2NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Acetic acid, 2-(2,4-dichlorophenoxy)-mixt. with S-ethyl dipropylcarbamothioate |
|---|
Chemical & Physical Properties
| Molecular Formula | C17H25Cl2NO4S |
|---|
| Molecular Weight | 410.4 |
|---|
| InChIKey | MXBJOJZUURPVBB-UHFFFAOYSA-N |
|---|
| SMILES | CCCN(CCC)C(=O)SCC.O=C(O)COc1ccc(Cl)cc1Cl |
|---|