Introduction:Basic information about CAS 334529-59-8|Ethanaminium, 2-hydroxy-N,N,N-trimethyl-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-N-[, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethanaminium, 2-hydroxy-N,N,N-trimethyl-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-N-[(nonafluorobutyl)sulfonyl]butanesulfonamide (1:1) |
|---|
| CAS Number | 334529-59-8 | Molecular Weight | 684.4 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C13H14F18N2O5S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Ethanaminium, 2-hydroxy-N,N,N-trimethyl-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-N-[(nonafluorobutyl)sulfonyl]butanesulfonamide (1:1) |
|---|
Chemical & Physical Properties
| Molecular Formula | C13H14F18N2O5S2 |
|---|
| Molecular Weight | 684.4 |
|---|
| InChIKey | AHIWQBVOCFKPHF-UHFFFAOYSA-N |
|---|
| SMILES | C[N+](C)(C)CCO.O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|