Introduction：Basic information about CAS 185424-97-9|D-Glucose, 3-(3,4,5-trihydroxybenzoate), cyclic 4a1:6a2-ester with (1S)-1-(6-carboxy, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | D-Glucose, 3-(3,4,5-trihydroxybenzoate), cyclic 4a1:6a2-ester with (1S)-1-(6-carboxy-2,3,4-trihydroxyphenyl)-4,6,7,8-tetrahydroxydibenzo[b,e][1,4]dioxin-2-carboxylic acid |
|---|
| CAS Number | 185424-97-9 | Molecular Weight | 756.5 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C33H24O21 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | D-Glucose, 3-(3,4,5-trihydroxybenzoate), cyclic 4a1:6a2-ester with (1S)-1-(6-carboxy-2,3,4-trihydroxyphenyl)-4,6,7,8-tetrahydroxydibenzo[b,e][1,4]dioxin-2-carboxylic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C33H24O21 |
|---|
| Molecular Weight | 756.5 |
|---|
| InChIKey | ZIWUSEBLXCYTOC-UHFFFAOYSA-N |
|---|
| SMILES | O=CC(O)C(OC(=O)c1cc(O)c(O)c(O)c1)C1OC(=O)c2cc(O)c(O)c(O)c2-c2c(cc(O)c3c2Oc2cc(O)c(O)c(O)c2O3)C(=O)OCC1O |
|---|
