Introduction：Basic information about (-)-Arctigenin CAS 7770-78-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(-)-Arctigenin Basic information
| Product Name: | (-)-Arctigenin |
| Synonyms: | (3R,4R)-4-[(3,4-DIMETHOXYPHENYL)METHYL]DIHYDRO-3-[(4-HYDROXY-3-METHOXYPHENYL)METHYL]-2(3H)-FURANONE;2(3H)-FURANONE,4-[(3,4-DIMETHOXYPHENYL)METHYL]DIHYDRO-3-[(4-HYDROXY-3-METHOXYPHENYL)METHYL]-,(3R,4R);2(3H)-FURANONE,4-[(3,4-DIMETHOXYPHENYL)METHYL]DIHYDRO-3-[(4-HYDROXY-3-METHOXYPHENYL)METHYL];ARCTIGENIN:2(3H)-FURANONE,4-[(3,4-DIMETHOXYPHENYL)METHYL]DIHYDRO-3-[(4-HYDROXY-3-METHOXYPHENYL)METHYL]-,(3R,4R);2(3H)-Furanone,4-[(3,4-dimethoxyphenyl) methyl];dihydro-3-[(4-hydroxy-3-methoxyphenyl)methyl]-,(3R,4R)-;ARCTIGENIN;ARCTIGENIN(P) |
| CAS: | 7770-78-7 |
| MF: | C21H24O6 |
| MW: | 372.41 |
| EINECS: | |
| Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;Inhibitors;Miscellaneous Natural Products;Protein Kinase |
| Mol File: | 7770-78-7.mol |
|
(-)-Arctigenin Chemical Properties
| Melting point | 98.0 to 102.0 °C |
| Boiling point | 567.0±45.0 °C(Predicted) |
| density | 1.227±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | DMSO: 34 mg/mL with heating and sonicating, soluble |
| form | solid |
| pka | 10.03±0.20(Predicted) |
| color | White to Light yellow |
| λmax | 280nm(EtOH)(lit.) |
| Major Application | metabolomics
vitamins, nutraceuticals, and natural products |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChI | InChI=1S/C21H24O6/c1-24-18-7-5-13(11-20(18)26-3)8-15-12-27-21(23)16(15)9-14-4-6-17(22)19(10-14)25-2/h4-7,10-11,15-16,22H,8-9,12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | NQWVSMVXKMHKTF-JKSUJKDBSA-N |
| SMILES | O1C[C@H](CC2=CC=C(OC)C(OC)=C2)[C@@H](CC2=CC=C(O)C(OC)=C2)C1=O |
| LogP | 2.470 (est) |
| CAS DataBase Reference | 7770-78-7(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | LY9247000 |
| HS Code | 2932.20.4500 |
| Storage Class | 11 - Combustible Solids |
(-)-Arctigenin Usage And Synthesis
| Chemical Properties | White crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from Arctium lappa, Trachelospermi chinensis, Rhizoma Cynanchum, Saussurea jellyfish and Forsythia suspensa. |
| Uses | Arctigenin is a plant ligan associated with anticancer and antioxidant properties. |
| Definition | ChEBI: (-)-Arctigenin is a lignan. |
| Biological Activity | Antioxidant, anti-inflammatory, antiproliferative and antiviral agent. Inhibits LPS-induced iNOS expression via inhibition of I κ B α phosphorylation and p65 nuclear translocation (IC 50 = 10 nM). Inhibits HIV-1 replication in vitro . Also potently inhibits MKK1 (IC 50 = 0.5 nM) and provides neuroprotection by binding to kainate receptors. |
| storage | -20°C (desiccate) |
(-)-Arctigenin Preparation Products And Raw materials
