Introduction:Basic information about (-)-NORTRACHELOGENIN CAS 34444-37-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(-)-NORTRACHELOGENIN Basic information
| Product Name: | (-)-NORTRACHELOGENIN |
| Synonyms: | (-)-Wikstromol;(3S)-4,5-Dihydro-4β-(4-hydroxy-3-methoxybenzyl)-3-(4-hydroxy-3-methoxybenzyl)-3β-hydroxyfuran-2(3H)-one;(3S,4S)-4,5-Dihydro-3,4-bis(4-hydroxy-3-methoxybenzyl)-3-hydroxyfuran-2(3H)-one;(3S,4S)-4,5-Dihydro-3-hydroxy-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]furan-2(3H)-one;Pinopalustrin;2(3H)-Furanone,dihydro-3-hydroxy-3,4-bis((4-hydroxy-3-methoxyphenyl)methyl)-,(3R-cis);8'-(R)-4,4',8-Trihydroxy-3,3'-dimethoxylignanolide;Dibenzylbutyrolactone |
| CAS: | 34444-37-6 |
| MF: | C20H22O7 |
| MW: | 374.38 |
| EINECS: | 200-158-5 |
| Product Categories: | |
| Mol File: | 34444-37-6.mol |
|
(-)-NORTRACHELOGENIN Chemical Properties
| Boiling point | 609.1±50.0 °C(Predicted) |
| density | 1.370±0.06 g/cm3(Predicted) |
| pka | 10.02±0.20(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C20H22O7/c1-25-17-8-12(3-5-15(17)21)7-14-11-27-19(23)20(14,24)10-13-4-6-16(22)18(9-13)26-2/h3-6,8-9,14,21-22,24H,7,10-11H2,1-2H3/t14-,20-/m0/s1 |
| InChIKey | ZITBJWXLODLDRH-XOBRGWDASA-N |
| SMILES | O1C[C@H](CC2=CC=C(O)C(OC)=C2)[C@@](O)(CC2=CC=C(O)C(OC)=C2)C1=O |
| LogP | 0.920 (est) |
Safety Information
| Hazard Codes | N |
| Risk Statements | 50 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9 / PGIII |
(-)-NORTRACHELOGENIN Usage And Synthesis
| Uses | Nortrachelogenin ((-)-Wikstromol) from Partrinia scabiosaefolia elicits an apoptotic response in Candida albicans[1]. |
| Definition | ChEBI: Nortrachelogenin is a lignan. |
| References | [1] Heejeong Lee, et al. (-)-Nortrachelogenin from Partrinia scabiosaefolia elicits an apoptotic response in Candida albicans. FEMS Yeast Res. 2016 May;16(3):fow013. DOI:10.1093/femsyr/fow013 |
(-)-NORTRACHELOGENIN Preparation Products And Raw materials