Introduction：Basic information about (+)-B-HYDRASTINE HCL CAS 5936-28-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(+)-B-HYDRASTINE HCL Basic information
| Product Name: | (+)-B-HYDRASTINE HCL |
| Synonyms: | (+)-B-HYDRASTINE HCL;(+)-BETA-HYDRASTINE HCL;ISOCORYNE HYDROCHLORIDE;HYDRASTINE HCL, (+)-B-;HYDRASTINE HYDROCHLORIDE;Hydrastinine (base and/or unspecified salts);(1R,9S)-(+)-β-Hydrastine hydrochloride;HYDRASTINE HCl, (+)-B-(P) |
| CAS: | 5936-28-7 |
| MF: | C21H22ClNO6 |
| MW: | 419.86 |
| EINECS: | 227-692-9 |
| Product Categories: | Alkaloids |
| Mol File: | 5936-28-7.mol |
|
(+)-B-HYDRASTINE HCL Chemical Properties
| Melting point | 115°C |
| alpha | D17 +127° (c = 4 in dil HCl) |
| storage temp. | −20°C |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C21H21NO6.ClH/c1-22-7-6-11-8-15-16(27-10-26-15)9-13(11)18(22)19-12-4-5-14(24-2)20(25-3)17(12)21(23)28-19;/h4-5,8-9,18-19H,6-7,10H2,1-3H3;1H/t18-,19+;/m1./s1 |
| InChIKey | URBFHJWLYXILMP-VOMIJIAVSA-N |
| SMILES | Cl.COc1ccc2[C@H](OC(=O)c2c1OC)[C@@H]3N(C)CCc4cc5OCOc5cc34 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| RIDADR | 1544 |
| WGK Germany | WGK 3 |
| RTECS | MU6125000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
(+)-B-HYDRASTINE HCL Usage And Synthesis
| Uses | Hydrastine hydrochloride EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. |
| Biological Activity | Tyrosine hydroxylase inhibitor. Reduces dopamine content in PC12 cells. |
(+)-B-HYDRASTINE HCL Preparation Products And Raw materials
