Introduction：Basic information about (+/-)-2-(6-METHOXY-2-NAPHTHYL)PROPIONIC ACID CAS 23981-80-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(+/-)-2-(6-METHOXY-2-NAPHTHYL)PROPIONIC ACID Basic information
| Product Name: | (+/-)-2-(6-METHOXY-2-NAPHTHYL)PROPIONIC ACID |
| Synonyms: | (+/-)-6-METHOXY-ALPHA-METHYL-2-NAPHTHALENEACETIC ACID;AKOS B006488;DL-NAPROXEN;DL-2-(6-METHOXY-2-NAPHTHYL)PROPIONIC ACID;LABOTEST-BB LT00452004;(+-)-2-(6-Methoxy-2-naphthalenyl)propionic acid;(+-)-6-Methoxy-a-methyl-2-naphthaleneacetic acid;(RS)-Naproxen |
| CAS: | 23981-80-8 |
| MF: | C14H14O3 |
| MW: | 230.26 |
| EINECS: | 245-969-2 |
| Product Categories: | Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals;Pharmaceutical Intermediates |
| Mol File: | 23981-80-8.mol |
|
(+/-)-2-(6-METHOXY-2-NAPHTHYL)PROPIONIC ACID Chemical Properties
| Melting point | 157°C |
| Boiling point | 403.9±20.0 °C(Predicted) |
| density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 4.84±0.30(Predicted) |
| form | Solid |
| color | White to Light red to Green |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16) |
| InChIKey | CMWTZPSULFXXJA-UHFFFAOYSA-N |
| SMILES | O(C)c1cc2c(cc(cc2)C(C)C(=O)O)cc1 |
| CAS DataBase Reference | 23981-80-8(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 2811 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29189900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
(+/-)-2-(6-METHOXY-2-NAPHTHYL)PROPIONIC ACID Usage And Synthesis
| Chemical Properties | White Solid |
| Uses | An anti-inflammatory, analgesic, antipyretic. A non-steroidal anti-inflammatory. |
| Definition | ChEBI: 2-(6-methoxy-2-naphthalenyl)propanoic acid is a member of naphthalenes. |
(+/-)-2-(6-METHOXY-2-NAPHTHYL)PROPIONIC ACID Preparation Products And Raw materials
| Raw materials | 6-methoxy-alpha-methylnaphthalen-1-acetaldehyde-->NAPRO-003-->(±)-5-bromo-6-methoxy-alpha-methylnaphthalene-2-acetic acid-->2-(6-methoxynaphthalen-2-yl)propanenitrile-->2-(1-chloroethyl)-6-methoxynaphthalene-->NAPROXEN METHYL ESTER-->6-Methoxy-2-vinylnaphthalene-->Trimethoxymethane-->carbon monoxide-->Carbon dioxide |
| Preparation Products | Ethyl 2-(6-methoxy-2-naphthyl)propanoate-->6-Methoxy-2-Acetyl Naphthalene-->2-Acetyl-6-methoxynaphthalene |
