Introduction：Basic information about (+/-)-TRANS-EPOXYSUCCINIC ACID CAS 141-36-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(+/-)-TRANS-EPOXYSUCCINIC ACID Basic information
| Product Name: | (+/-)-TRANS-EPOXYSUCCINIC ACID |
| Synonyms: | (+/-)-TRANS-2,3-OXIRANEDICARBOXYLIC ACID;(+/-)-TRANS-EPOXYSUCCINIC ACID;trans-2,3-Epoxysuccinic acid;(+/-)-TRANS-EPOXYSUCCINIC ACID 97+%;DL-trans-Epoxysuccinic acid;rac-Oxirane-2α*,3β*-dicarboxylic acid;(+/-)-trans-Oxirane-2,3-dicarboxylic acid;)-trans-Epoxysuccinic Acid |
| CAS: | 141-36-6 |
| MF: | C4H4O5 |
| MW: | 132.07 |
| EINECS: | |
| Product Categories: | Oxiranes;Simple 3-Membered Ring Compounds |
| Mol File: | 141-36-6.mol |
|
(+/-)-TRANS-EPOXYSUCCINIC ACID Chemical Properties
| Melting point | 210-216°C |
| Boiling point | 467.5±45.0 °C(Predicted) |
| density | 1.920±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| pka | 2.84±0.40(Predicted) |
| color | White to Almost white |
| InChI | InChI=1/C4H4O5/c5-3(6)1-2(9-1)4(7)8/h1-2H,(H,5,6)(H,7,8)/t1-,2-/s3 |
| InChIKey | DCEMCPAKSGRHCN-DLDCVFTPNA-N |
| SMILES | O1[C@@H](C(O)=O)[C@@H]1C(O)=O |&1:1,5,r| |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 2917.20.0000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
(+/-)-TRANS-EPOXYSUCCINIC ACID Usage And Synthesis
| Definition | ChEBI: Trans-2,3-epoxysuccinic acid is the trans-2,3-epoxy derivative of succinic acid. It is an epoxide and a C4-dicarboxylic acid. It is functionally related to a succinic acid. It is a conjugate acid of a trans-2,3-epoxysuccinate(2-). |
(+/-)-TRANS-EPOXYSUCCINIC ACID Preparation Products And Raw materials
| Preparation Products | DL-Tartaric acid |
