Introduction：Basic information about (3S)-3-(2-thienylthio)butanoic acid CAS 133359-80-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(3S)-3-(2-thienylthio)butanoic acid Basic information
| Product Name: | (3S)-3-(2-thienylthio)butanoic acid |
| Synonyms: | (3S)-3-(2-thienylthio)butanoic acid;(S)-3-(2-Thienylthio)butanoic acid;(S)-3-(thiophen-2-ylthio)butanoic acid;Butanoic acid, 3-(2-thienylthio)-, (3S)-;3-(thiophen-2-ylthio)butanoic acid;(3S)-3-THIOPHEN-2-YLSULFANYLBUTANOIC ACID;(3S)-3-(2-thienylthio)butyric acid |
| CAS: | 133359-80-5 |
| MF: | C8H10O2S2 |
| MW: | 202.29 |
| EINECS: | 948-811-7 |
| Product Categories: | |
| Mol File: | 133359-80-5.mol |
|
(3S)-3-(2-thienylthio)butanoic acid Chemical Properties
| Boiling point | 354.6±22.0 °C(Predicted) |
| density | 1.30 |
| storage temp. | 2-8°C |
| pka | 4.25±0.10(Predicted) |
| InChI | InChI=1S/C8H10O2S2/c1-6(5-7(9)10)12-8-3-2-4-11-8/h2-4,6H,5H2,1H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | SIFFRIHCTBGQTC-LURJTMIESA-N |
| SMILES | C(O)(=O)C[C@@H](SC1SC=CC=1)C |
Safety Information
(3S)-3-(2-thienylthio)butanoic acid Usage And Synthesis
| Uses | (3S)-3-(2-thienylthio)butanoic acid is an intermediate of Dorzolamide. |
(3S)-3-(2-thienylthio)butanoic acid Preparation Products And Raw materials
| Raw materials | r-butyrolactone-->Methyl (3S)-3-(2-thienylthio)butanoate-->(3S)-3-(2-Thienylthio)butanoic acid compd. with (alphaR)-alpha-methylbenzenemethanamine-->Thiophene(SIV) (9CI) |
| Preparation Products | 4H-Thieno[2,3-b]thiopyran-4-one,5,6-dihydro-6-methyl-, 7,7-dioxide, (6S) |
