Introduction:Basic information about (N-ACETYL)-(4R)-BENZYL-2-OXAZOLIDINONE CAS 132836-66-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(N-ACETYL)-(4R)-BENZYL-2-OXAZOLIDINONE Basic information
| Product Name: | (N-ACETYL)-(4R)-BENZYL-2-OXAZOLIDINONE |
| Synonyms: | (4R)-3-ACETYL-4-BENZYL-1,3-OXAZOLIDIN-2-ONE;(4S)-3-ACETYL-4-BENZYL-1,3-OXAZOLIDIN-2-ONE;(4S)-3-ACETYL-4-(PHENYLMETHYL)-2-OXAZOLIDINONE;TIMTEC-BB SBB010012;(S)-(+)-3-ACETYL-4-BENZYL-2-OXAZOLIDINONE;(S)-3-ACETYL-4-BENZYL-2-OXAZOLIDINONE;(R)-(-)-3-ACETYL-4-BENZYL-2-OXAZOLIDINONE;(N-ACETYL)-(4R)-BENZYL-2-OXAZOLIDINONE |
| CAS: | 132836-66-9 |
| MF: | C12H13NO3 |
| MW: | 219.24 |
| EINECS: | |
| Product Categories: | Oxazolidinone;Peptide;Asymmetric Synthesis;Chiral Auxiliaries;Oxazolidinone Derivatives |
| Mol File: | 132836-66-9.mol |
|
(N-ACETYL)-(4R)-BENZYL-2-OXAZOLIDINONE Chemical Properties
| Melting point | 104-106 °C(lit.) |
| alpha | +110°(20℃, c=1, CH3OH) |
| Boiling point | 360.05°C (rough estimate) |
| density | 1.1825 (rough estimate) |
| refractive index | 1.5270 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | -2.27±0.40(Predicted) |
| form | solid |
| Optical Rotation | [α]20/D +110°, c = 1 in methanol |
| InChI | 1S/C12H13NO3/c1-9(14)13-11(8-16-12(13)15)7-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3/t11-/m0/s1 |
| InChIKey | YMVGXIZVSPMNPD-NSHDSACASA-N |
| SMILES | CC(=O)N1[C@H](COC1=O)Cc2ccccc2 |
| CAS DataBase Reference | 132836-66-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
(N-ACETYL)-(4R)-BENZYL-2-OXAZOLIDINONE Usage And Synthesis
| Chemical Properties | offwhite crystals |
| Uses | Versatile chiral auxiliary for asymmetric synthesis. |
(N-ACETYL)-(4R)-BENZYL-2-OXAZOLIDINONE Preparation Products And Raw materials
| Preparation Products | (S)-4-Benzyl-3-propionyl-2-oxazolidinone-d3 |