(OXYDI-2,1-PHENYLENE)BIS(DIPHENYLPHOSPHINE) CAS 166330-10-5
Introduction:Basic information about (OXYDI-2,1-PHENYLENE)BIS(DIPHENYLPHOSPHINE) CAS 166330-10-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(OXYDI-2,1-PHENYLENE)BIS(DIPHENYLPHOSPHINE) Basic informationReaction
| Product Name: | (OXYDI-2,1-PHENYLENE)BIS(DIPHENYLPHOSPHINE) |
| Synonyms: | 1-(diphenylphosphino)-2-(2-(diphenylphosphino)phenoxy)benzene;DPEPHOS [(Oxydi-2,1-phenylene)-bis-(diphenylphosphine)];Bis(2-diphenylphosphinophenyl)ether, 99% DPEphos;Bis(2-diphenylphosphinophenl)ether;{2-[2-(diphenylphosphanyl)phenoxy]phenyl}diphenylphosphane;Bis(2-diphenylphosphinophenyl) ether 98% Min;Bis(2-diphenylphosphinophenyl)ether, 99% 25GR;Bis(2-diphenylphosphinophenyl)ether, 99% 5GR |
| CAS: | 166330-10-5 |
| MF: | C36H28OP2 |
| MW: | 538.55 |
| EINECS: | 678-206-0 |
| Product Categories: | organophosphine ligand;Phosphine Ligands;Synthetic Organic Chemistry;Catalysis and Inorganic Chemistry;Phosphorus Compounds;Polydentate Phosphine Ligands;Pyridazines;Achiral Phosphine;Aryl Phosphine |
| Mol File: | 166330-10-5.mol |
(OXYDI-2,1-PHENYLENE)BIS(DIPHENYLPHOSPHINE) Chemical Properties
| Melting point | 184-187 °C (lit.) |
| Boiling point | 608.2±40.0 °C(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder or Crystals |
| color | White to off-white |
| BRN | 7729718 |
| InChI | InChI=1S/C36H28OP2/c1-5-17-29(18-6-1)38(30-19-7-2-8-20-30)35-27-15-13-25-33(35)37-34-26-14-16-28-36(34)39(31-21-9-3-10-22-31)32-23-11-4-12-24-32/h1-28H |
| InChIKey | RYXZOQOZERSHHQ-UHFFFAOYSA-N |
| SMILES | C1C=CC(OC2C=CC=CC=2P(C2=CC=CC=C2)C2C=CC=CC=2)=C(P(C2C=CC=CC=2)C2=CC=CC=C2)C=1 |
| CAS DataBase Reference | 166330-10-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Reaction |
|
| Chemical Properties | White to off-white crystalline powder or crystals |
| Uses | suzuki reaction |
| Uses | Ligand for ruthenium-catalyzed greener amine synthesis from amines and alcohols by hydrogen-borrowing. Ruthenium-Catalyzed N-Alkylation of Amines and Sulfonamides Using Borrowing Hydrogen Methodology |
| General Description | This product has been enhanced for catalytic efficiency. |
| reaction suitability | reagent type: ligand reaction type: Buchwald-Hartwig Cross Coupling Reaction reagent type: ligand reaction type: Heck Reaction reagent type: ligand reaction type: Hydroaminations reagent type: ligand reaction type: Negishi Coupling reagent type: ligand reaction type: Suzuki-Miyaura Coupling |
(OXYDI-2,1-PHENYLENE)BIS(DIPHENYLPHOSPHINE) Preparation Products And Raw materials
| Raw materials | Ethanol-->Ethyl acetate-->Tetrahydrofuran-->n-Butyllithium-->Diphenyl ether-->N,N,N',N'-Tetramethylethylenediamine-->Chlorodiphenylphosphine |
| Preparation Products | 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)aniline-->Porphine-->4,5-Bis(diphenylphosphino)-9,9-dimethylxanthene |
