Introduction:Basic information about (S)-(-)-2-ACETOXYPROPIONYL CHLORIDE CAS 36394-75-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(S)-(-)-2-ACETOXYPROPIONYL CHLORIDE Basic information
| Product Name: | (S)-(-)-2-ACETOXYPROPIONYL CHLORIDE |
| Synonyms: | (S)-(-)-O-ACETYLLACTOYL CHLORIDE;(S)-(-)-2-ACETOXYPROPIONYL CHLORIDE;(S)-2-ACETOXYPROPIONYL CHLORIDE;S-ACETOXYPROPIONYL CHLORIDE;O-ACETYL-L-LACTYL CHLORIDE;AP-CL;2-Acetoxy propionyl chloride;acetic acid (1-chloro-1-oxopropan-2-yl) ester |
| CAS: | 36394-75-9 |
| MF: | C5H7ClO3 |
| MW: | 150.56 |
| EINECS: | 420-610-4 |
| Product Categories: | synthons |
| Mol File: | 36394-75-9.mol |
|
(S)-(-)-2-ACETOXYPROPIONYL CHLORIDE Chemical Properties
| alpha | -31o (C=4 IN CHLOROFORM) |
| Boiling point | 50 °C5 mm Hg(lit.) |
| density | 1.189 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.423(lit.) |
| Fp | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Sparingly) |
| form | clear liquid |
| Specific Gravity | 1.19 |
| color | Colorless to Light yellow |
| Optical Rotation | [α]20/D 31°, c = 4 in chloroform |
| BRN | 1722943 |
| Stability: | Hygroscopic, Moisture sensitive |
| InChI | InChI=1S/C5H7ClO3/c1-3(5(6)8)9-4(2)7/h3H,1-2H3/t3-/m0/s1 |
| InChIKey | ALHZEIINTQJLOT-VKHMYHEASA-N |
| SMILES | C(Cl)(=O)[C@@H](OC(C)=O)C |
| CAS DataBase Reference | 36394-75-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-43-22 |
| Safety Statements | 26-36/37/39-45-23 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2918199890 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B Skin Sens. 1 |
(S)-(-)-2-ACETOXYPROPIONYL CHLORIDE Usage And Synthesis
| Uses | Frequently used chiral building block. Also used to resolve a bicyclic α-hydroxylactone and to prepare chiral phosphonates used in an enantiomeric excess assay of unprotected amino acids. Useful chiral derivatizing agent. |
| Purification Methods | It is moisture sensitive and is hydrolysed to the corresponding acid. Check the IR spectrum. If the OH band above 3000cm -1 is too large and broad then the mixture should be refluxed with pure acetyl chloride for 1hour, evaporated and distilled under reduced pressure. [Julia & Sans J Chromatographic Sci 17 651 1979, Dolittle & Heath J Org Chem 49 5041 1984, Beilstein 3 II 189.] |
(S)-(-)-2-ACETOXYPROPIONYL CHLORIDE Preparation Products And Raw materials