Introduction：Basic information about 1,1,2,2-TETRACHLOROETHANE-D2 CAS 33685-54-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 1,1,2,2-TETRACHLOROETHANE-D2 Basic information
- 2. 1,1,2,2-TETRACHLOROETHANE-D2 Chemical Properties
- 3. Safety Information
- 4. 1,1,2,2-TETRACHLOROETHANE-D2 Usage And Synthesis
- 5. 1,1,2,2-TETRACHLOROETHANE-D2 Preparation Products And Raw materials
1,1,2,2-TETRACHLOROETHANE-D2 Basic information
| Product Name: | 1,1,2,2-TETRACHLOROETHANE-D2 |
| Synonyms: | 1,1,2,2-tetrachloro-[1,2-2H2]ethane;1,1,2,2-TETRACHLOROETHANE-D2, 99.5+ ATOM % D;1,1,2,2-TETRACHLOROETHANE-D2 DEUTERATION DEGREE MIN. 99 ATOM % D;1,1,2,2-TETRACHLOROETHANE-D2 DEUTE-RATIO N DEGREE MIN. 99,5 ATOM % D;1,1,2,2-TetrachloroethaneGr;1,1,2,2-Tetrachloroethane-d2, 99 atom % D, for NMR;ACETYLENE TETRACHLORIDE;TETRACHLOROETHANE D2 |
| CAS: | 33685-54-0 |
| MF: | C2Cl4D2 |
| MW: | 169.86 |
| EINECS: | 251-634-1 |
| Product Categories: | |
| Mol File: | 33685-54-0.mol |
|
1,1,2,2-TETRACHLOROETHANE-D2 Chemical Properties
| Melting point | -44°C |
| Melting point | -44°C |
| Boiling point | 145-146 °C737 mm Hg(lit.) |
| Boiling point | 146,5°C |
| density | 1.62 g/mL at 25 °C(lit.) |
| density | d = 1,62 |
| vapor pressure | 6.6 hPa (20 °C) |
| refractive index | n20/D 1.493(lit.) |
| Fp | 147°C |
| storage temp. | Storage temperature: no restrictions. |
| solubility | 3g/l |
| form | Liquid |
| color | Colorless |
| Specific Gravity | 1.62 |
| Water Solubility | Slightly soluble in water. Soluble in ether, chloroform, ethanol, tetrachloromethane, methanol, acetone, petroleum spirit, carbon disulfide, dimethyl formamide and benzene. |
| BRN | 1699903 |
| Stability: | Volatile |
| InChI | 1S/C2H2Cl4/c3-1(4)2(5)6/h1-2H/i1D,2D |
| InChIKey | QPFMBZIOSGYJDE-QDNHWIQGSA-N |
| SMILES | ClC(Cl)(C(Cl)(Cl)[2H])[2H] |
| CAS DataBase Reference | 33685-54-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1,1,2,2-Tetrachloroethane-d2 (33685-54-0) |
Safety Information
| Hazard Codes | T+,N |
| Risk Statements | 26/27-51/53 |
| Safety Statements | 38-45-61 |
| RIDADR | UN 1702 6.1/PG 2 |
| WGK Germany | 3 |
| F | 8-10 |
| HS Code | 2845 90 10 |
| HazardClass | 6.1 |
| PackingGroup | II |
| Storage Class | 6.1B - Non-combustible, acute toxic Cat. 1 and 2
very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal
Acute Tox. 2 Inhalation
Aquatic Chronic 2 |
1,1,2,2-TETRACHLOROETHANE-D2 Usage And Synthesis
| Chemical Properties | clear colorless liquid |
| Uses | Isotope labelled 1,1,2,2-Tetrachloroethane is a material used in the manufacturing of thermoelectric material including carbon nanotubes. It was primarily used as a solvent however due to toxicity it is no longer a viable compound. |
| Definition | ChEBI: 1,1,2,2-tetrachlorethane-d2 is a deuterated compound and a member of chloroethanes. |
1,1,2,2-TETRACHLOROETHANE-D2 Preparation Products And Raw materials
| Preparation Products | Trichloroethylene-->Tetrachloroethylene-->1,2-DICHLOROETHYLENE-->3-Benzoylbenzyl bromide-->1,1-DICHLORO-2,2-DIFLUOROETHYLENE-->methoxyflurane |
