Introduction：Basic information about 1,1′-Biphenyl-2,2′,3,3′,4,4′,5,6,6′-d9, 5′-bromo- CAS 2363789-28-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 1,1′-Biphenyl-2,2′,3,3′,4,4′,5,6,6′-d9, 5′-bromo- Basic information
- 2. 1,1′-Biphenyl-2,2′,3,3′,4,4′,5,6,6′-d9, 5′-bromo- Chemical Properties
- 3. Safety Information
- 4. 1,1′-Biphenyl-2,2′,3,3′,4,4′,5,6,6′-d9, 5′-bromo- Usage And Synthesis
- 5. 1,1′-Biphenyl-2,2′,3,3′,4,4′,5,6,6′-d9, 5′-bromo- Preparation Products And Raw materials
1,1′-Biphenyl-2,2′,3,3′,4,4′,5,6,6′-d9, 5′-bromo- Basic information
| Product Name: | 1,1′-Biphenyl-2,2′,3,3′,4,4′,5,6,6′-d9, 5′-bromo- |
| Synonyms: | 3-bromo-1,1'-biphenyl-2,2',3',4,4',5,5',6,6'-d9;3-bromo-1,1'-biphenyl-d9;3-Bromobiphenyl-D9;1,1′-Biphenyl-2,2′,3,3′,4,4′,5,6,6′-d9, 5′-bromo- |
| CAS: | 2363789-28-8 |
| MF: | C12BrD9 |
| MW: | 242.16 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 2363789-28-8.mol |
|
1,1′-Biphenyl-2,2′,3,3′,4,4′,5,6,6′-d9, 5′-bromo- Chemical Properties
| Boiling point | 300.000±9.00 °C(Press: 760.00 Torr)(predicted) |
| density | 1.364±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| InChI | InChI=1S/C12H9Br/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| InChIKey | USYQKCQEVBFJRP-UHFFFAOYSA-N |
| SMILES | BrC1=C([H])C([H])=C([H])C(C2C([H])=C([H])C([H])=C([H])C=2[H])=C1[H] |
Safety Information
1,1′-Biphenyl-2,2′,3,3′,4,4′,5,6,6′-d9, 5′-bromo- Usage And Synthesis
| Uses | 1,1′-Biphenyl-2,2′,3,3′,4,4′,5,6,6′-d9, 5′-bromo- is used as a perdeuterated 3-bromobiphenyl building block for isotope-labeled OLED and pharmaceutical intermediates. |
1,1′-Biphenyl-2,2′,3,3′,4,4′,5,6,6′-d9, 5′-bromo- Preparation Products And Raw materials
