Introduction：Basic information about 1,1'-Oxydi-2-propanol CAS 110-98-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,1'-Oxydi-2-propanol Basic information
| Product Name: | 1,1'-Oxydi-2-propanol |
| Synonyms: | ,’-Dihydroxy-dipropylether;1,1’-dimethyldiethyleneglycol;1,1’-oxybis-2-propano;1,1’-oxydi-2-propano;1,1'-Dimethyldiethylene glycol;2,2’-dihydroxydipropylether;2,2’-dihydroxyisopropylether;2,2'-Dihydroxydipropyl ether |
| CAS: | 110-98-5 |
| MF: | C6H14O3 |
| MW: | 134.17 |
| EINECS: | 203-821-4 |
| Product Categories: | |
| Mol File: | 110-98-5.mol |
|
1,1'-Oxydi-2-propanol Chemical Properties
| Melting point | -40 °C |
| Boiling point | 229-232 °C |
| density | 1.02 |
| vapor density | 4.63 |
| refractive index | 1.44-1.442 |
| Fp | 138 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 14.19±0.20(Predicted) |
| color | Colorless,sltly viscous liquid |
| Odor | nearly odorless |
| Cosmetics Ingredients Functions | FRAGRANCE
PERFUMING
VISCOSITY CONTROLLING
SOLVENT |
| InChI | InChI=1S/C6H14O3/c1-5(7)3-9-4-6(2)8/h5-8H,3-4H2,1-2H3 |
| InChIKey | AZUXKVXMJOIAOF-UHFFFAOYSA-N |
| SMILES | O(CC(O)C)CC(O)C |
| LogP | -0.820 |
| CAS DataBase Reference | 110-98-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propanol, 1,1'-oxydi-,(110-98-5) |
| EPA Substance Registry System | Bis(2-hydroxypropyl) ether (110-98-5) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| RTECS | UB8785000 |
| TSCA | TSCA listed |
| HS Code | 29094400 |
| Hazardous Substances Data | 110-98-5(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: 14,850 mg/kg 34ZIAG -,731,69 |
1,1'-Oxydi-2-propanol Usage And Synthesis
| Chemical Properties | Clear liquid |
| Uses | 1,1'-Oxydi-2-propanol is commonly used as a plasticizer, an intermediate in industrial chemical reactions. |
| Safety Profile | Mildly toxic by ingestion. A skin and eye irritant. Mutation data reported. Combustible when exposed to heat or flame, can react vigorously with oxidizing materials. To fight fire, use alcohol foam, CO2, dry chemical. When heated to decomposition it emits |
| Synthesis | Dipropylene glycol, propylene glycol, and tripropylene glycol are separated and purified from a crude mixture containing DPG using a three-column continuous vacuum distillation system. The operation involves linked operation of a propylene glycol column (removes PG and catalyst), a dipropylene glycol column (yields DPG product), and a tripropylene glycol column (yields TPG product). Each column controls specific parameters like kettle temperature, top temperature, pressure, vacuum, and reflux ratio for efficient separation. |
| Purification Methods | Fractionally distil the diol below 15mm pressure, using a packed column and taking precautions to avoid absorption of water. [Beilstein 1 IV 2473.] |
1,1'-Oxydi-2-propanol Preparation Products And Raw materials
| Raw materials | Sulfuric acid-->Propylene oxide-->Propylene glycol |
| Preparation Products | 3,5-DiMethylMorpholine |
