1,1'-SPIROBIINDANE-7,7'-DIOL CAS 223259-63-0
Introduction：Basic information about 1,1'-SPIROBIINDANE-7,7'-DIOL CAS 223259-63-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,1'-SPIROBIINDANE-7,7'-DIOL Basic information
| Product Name: | 1,1'-SPIROBIINDANE-7,7'-DIOL |
| Synonyms: | 1,1'-SPIROBIINDANE-7,7'-DIOL;(1S)-2,2',3,3'-tetrahydro-1,1'-Spirobi[1H-indene]-7,7'-diol;(S)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[INDENE]-7,7'-DIOL, >=95%;S-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diol;S-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-7,7'-diol;1,1'-Spirobi[1H-indene]-7,7'-diol,2,2',3,3'-tetrahydro-;1,1'-Spirobi[1H-indene]-7,7'-diol, 2,2',3,3'-tetrahydro-, (1S)-;S-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-di |
| CAS: | 223259-63-0 |
| MF: | C17H16O2 |
| MW: | 252.31 |
| EINECS: | |
| Product Categories: | BINOL Series;Chiral Oxygen;Chiral Spiro Ligand |
| Mol File: | 223259-63-0.mol |
1,1'-SPIROBIINDANE-7,7'-DIOL Chemical Properties
| Melting point | 155-156℃ |
| Boiling point | 433.0±45.0 °C(Predicted) |
| density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder to crystaline |
| pka | 9.70±0.20(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C17H16O2/c18-13-5-1-3-11-7-9-17(15(11)13)10-8-12-4-2-6-14(19)16(12)17/h1-6,18-19H,7-10H2 |
| InChIKey | YBRDFCQKQVTQKX-UHFFFAOYSA-N |
| SMILES | [C@]12(C3=C(C=CC=C3O)CC1)C1=C(C=CC=C1O)CC2 |
Safety Information
| HS Code | 2907.29.9000 |
| Uses | (S)-SPINOL is used to synthesis a new class of chiral phosphoric acids with spirobiindane as scaffold and employed to catalyze the asymmetric Friedel?Crafts reaction of indoles with imines to afford 3-indolyl methanamines. |
1,1'-SPIROBIINDANE-7,7'-DIOL Preparation Products And Raw materials
| Raw materials | Ethanol-->Sodium hydroxide-->Ethyl acetate-->Tetrahydrofuran-->Dichloromethane-->PETROLEUM ETHER-->Magnesium sulfate-->Acetone-->n-Butyllithium-->Hydrogen peroxide-->Hydrogen-->Nickel-->Sodium bromide-->Methanesulfonic acid-->Boron tribromide-->3-Hydroxybenzaldehyde-->Cinchonidine-->3-Methoxybenzaldehyde-->Phosphotungstic acid hydrate |
| Preparation Products | (S)-1,1'-SPIROBIINDANE-7,7'-DIOL-->(R)-1,1'-SPIROBIINDANE-7,7'-DIOL |
