Introduction：Basic information about 10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine CAS 3159-07-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine Basic information
- 2. 10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine Chemical Properties
- 3. Safety Information
- 4. 10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine Usage And Synthesis
- 5. 10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine Preparation Products And Raw materials
10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine Basic information
| Product Name: | 10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine |
| Synonyms: | 11-Oxo-10,11-dihydro-Dibenzo[b,f][1,4]thiazepine;10H-DIBENZO-(1,4)-THIAZEPINE-11-ONE;10,11-DIHYDRO-11-OXODIBENZO[B,F][1,4]THIAZEPINE;DIBENZO[B,F][1,4]THIAZEPINE-11-[10H]ONE (DBTO);10,11-Dihydro-11-oxo dibenzo-1,4-thiazepine;10H-DIBENZO[B,F][1,4]THIAZEPIN-11-ONE;DibenzoB,F1,4Thiazepine-11-(10H)One-Dptp;DIBENZO[B,F][1,4]THIAZEPINE-11-[10H]ONE |
| CAS: | 3159-07-7 |
| MF: | C13H9NOS |
| MW: | 227.28 |
| EINECS: | 608-646-0;438-020-0 |
| Product Categories: | Quetiapine;(intermediate of quetiapine fumarate);Intermediates of Quetiapine;Heterocycles;API intermediates;Pharmaceutical Intermediates |
| Mol File: | 3159-07-7.mol |
|
10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine Chemical Properties
| Melting point | 265 °C |
| Boiling point | 309.2±12.0 °C(Predicted) |
| density | 1.292±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | DMSO (Slightly, Heated) |
| form | Solid |
| pka | 12.40±0.20(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C13H9NOS/c15-13-9-5-1-3-7-11(9)16-12-8-4-2-6-10(12)14-13/h1-8H,(H,14,15) |
| InChIKey | RTERDTBXBYNZIS-UHFFFAOYSA-N |
| SMILES | S1C2=CC=CC=C2C(=O)NC2=CC=CC=C12 |
| CAS DataBase Reference | 3159-07-7(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| HS Code | 2934990002 |
| Storage Class | 11 - Combustible Solids |
10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine Usage And Synthesis
| Chemical Properties | Off-White Powder |
| Uses | Dibenzo[b,f][1,4]thiazepine-11-[10H]one (Quetiapine EP Impurity G; Quetiapine Impurity G; Quetiapine USP-G) is an intermediate in the synthesis of quetiapine (Q510000). |
10,11-Dihydro-11-oxodibenzo[b,f][1,4]thiazepine Preparation Products And Raw materials
| Preparation Products | Quetiapine DBTO Sulfone |
