Introduction:Basic information about 2-(2H-Benzothiazol-2-yl)-6-(dodecyl)-4-methylphenol CAS 125304-04-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-(2H-Benzothiazol-2-yl)-6-(dodecyl)-4-methylphenol Basic information
| Product Name: | 2-(2H-Benzothiazol-2-yl)-6-(dodecyl)-4-methylphenol |
| Synonyms: | Ultraviolet Absorber UV-571;Light stabilizer UV-571;2-(2H-BENZOTRIAZOL-2-YL)-6-DODECYL-4-;2-(2h-benzotriazol-2-yl)-6-dodecyl-4-methyl-phenobranchedandlinear;2-(2h-benzothiazol-2-yl)-6-(dodecyl)-4-methylphenol;-(2H-Benzothiazol-2-yl)-6-(dodecyl)-4-methylphenol;UV-571;BENZOTRIAZOLYL DODECYL p-CRESOL |
| CAS: | 125304-04-3 |
| MF: | C25H35N3O |
| MW: | 393.57 |
| EINECS: | 401-680-5 |
| Product Categories: | Polymer Additives;Polymer Science;Stabilizers |
| Mol File: | 125304-04-3.mol |
|
2-(2H-Benzothiazol-2-yl)-6-(dodecyl)-4-methylphenol Chemical Properties
| Melting point | >350 °C(lit.) |
| Boiling point | 414℃[at 101 325 Pa] |
| density | 0.911 g/mL at 25 °C(lit.) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n20/D 1.574(lit.) |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | H2O: <0.01 ppm at 20 °C, insoluble |
| Water Solubility | 130ng/L at 20℃ |
| Cosmetics Ingredients Functions | UV ABSORBER |
| InChI | InChI=1S/C25H35N3O/c1-3-4-5-6-7-8-9-10-11-12-15-21-18-20(2)19-24(25(21)29)28-26-22-16-13-14-17-23(22)27-28/h13-14,16-19,29H,3-12,15H2,1-2H3 |
| InChIKey | VQMHSKWEJGIXGA-UHFFFAOYSA-N |
| SMILES | N1(N=C2C=CC=CC2=N1)C1C=C(C=C(CCCCCCCCCCCC)C=1O)C |
| LogP | 8.9 at 25℃ |
| CAS DataBase Reference | 125304-04-3(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 2-(2H-benzotriazol-2-yl)-6-dodecyl-4-methyl-, branched and linear (125304-04-3) |
Safety Information
| Hazard Codes | N |
| Risk Statements | 51/53 |
| Safety Statements | 61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 4 |
2-(2H-Benzothiazol-2-yl)-6-(dodecyl)-4-methylphenol Usage And Synthesis
| Uses | 2-(2H-Benzothiazol-2-yl)-6-(dodecyl)-4-methylphenol is a uV-light absorber. It helps protect a product from deterioration because of uV-light exposure. |
| Uses | Low volatile liquid benzotriazole UV light absorber/stabilizer. Imparts outstanding light stability and protection efficiency without imparting any yellowness to the protected substrate. |
| Flammability and Explosibility | Not classified |
2-(2H-Benzothiazol-2-yl)-6-(dodecyl)-4-methylphenol Preparation Products And Raw materials