Introduction：Basic information about CAS 36437-37-3|2-(2H-Benzotriazol-2-yl)-4-(tert-butyl)-6-(sec-butyl)phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2H-Benzotriazol-2-yl)-4-(tert-butyl)-6-(sec-butyl)phenol |
|---|
| CAS Number | 36437-37-3 | Molecular Weight | 323.43200 |
|---|
| Density | 1.12g/cm3 | Boiling Point | 458ºC at 760mmHg |
|---|
| Molecular Formula | C20H25N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.8ºC |
|---|
Names
| Name | 2-(benzotriazol-2-yl)-6-butan-2-yl-4-tert-butylphenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.12g/cm3 |
|---|
| Boiling Point | 458ºC at 760mmHg |
|---|
| Molecular Formula | C20H25N3O |
|---|
| Molecular Weight | 323.43200 |
|---|
| Flash Point | 230.8ºC |
|---|
| Exact Mass | 323.20000 |
|---|
| PSA | 50.94000 |
|---|
| LogP | 4.93710 |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | RTNVDKBRTXEWQE-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)c1cc(C(C)(C)C)cc(-n2nc3ccccc3n2)c1O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| EINECS 253-037-1 |
| 2-benzotriazol-2-yl-4-tert-butyl-6-sec-butyl-phenol |
| 2-(2h-benzotriazol-2-yl)-6-sec-butyl-4-tert-butylphenol |
| 2-(2-Hydroxy-3-sec-butyl-5-tert-butylphenyl)-2H-benzotriazole |
| 2-(3-sec-Butyl-5-tert-butyl-2-hydroxyphenyl)benzotriazole |
| 2-(2-butyl)-4-tert-butyl-6-(4,5-benzo-1,2,3-triazol-2-yl)-phenol |
| 2-(1H-INDOL-2-YL)PHENOL |
| 2-(2H-Benzotriazol-2-yl)-4-(tert-butyl)-6-(sec-butyl)phenol |
| 2-(3'-sec-butyl-5'-tert-butyl-2'-hydroxyphenyl)-benzotriazole |
| 2-(2-hydroxy-3-s-butyl-5-t-butylphenyl)-benzotriazole |
