2,2,2-TRIFLUOROETHANOL-D3 CAS 77253-67-9
Introduction:Basic information about 2,2,2-TRIFLUOROETHANOL-D3 CAS 77253-67-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,2,2-TRIFLUOROETHANOL-D3 Basic information
| Product Name: | 2,2,2-TRIFLUOROETHANOL-D3 |
| Synonyms: | 2,2,2-TRIFLUOROETHANOL-D2;2,2,2-TRIFLUOROETHANOL-D3;2,2,2-TRIFLUOROETHYL-1,1-D2 ALCOHOL;TRIFLUOROETHYL ALCOHOL D2;TRIFLUOROETHYL ALCOHOL D3;TRIFLUOROETHYL-D2 ALCOHOL-D;TRIFLUOROETHANOL-D2;TRIFLUOROETHANOL-D3 |
| CAS: | 77253-67-9 |
| MF: | C2D3F3O |
| MW: | 103.06 |
| EINECS: | 278-649-6 |
| Product Categories: | Alphabetical Listings;NMR - SolventsStable Isotopes;NMR Solvents and Reagents;NMRStable Isotopes;Stable Isotopes |
| Mol File: | 77253-67-9.mol |
2,2,2-TRIFLUOROETHANOL-D3 Chemical Properties
| Melting point | -44°C |
| Melting point | -44 °C(lit.) |
| Boiling point | 77-80 °C(lit.) |
| Boiling point | 77-80°C |
| density | 1.415 g/mL at 25 °C(lit.) |
| density | d = 1,45 |
| refractive index | n |
| Fp | 85 °F |
| storage temp. | Flammables area |
| form | Liquid |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C2H3F3O/c3-2(4,5)1-6/h6H,1H2/i1D2,6D |
| InChIKey | RHQDFWAXVIIEBN-IDPMSXFZSA-N |
| SMILES | C(F)(F)(F)C([2H])([2H])O[2H] |
| CAS DataBase Reference | 77253-67-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,F |
| Risk Statements | 10-20/21/22-38-41-48/20 |
| Safety Statements | 16-26 |
| RIDADR | UN 1987 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 28459010 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Dam. 1 Flam. Liq. 3 Repr. 1B STOT RE 2 Inhalation |
| Chemical Properties | clear colorless liquid |
| Uses | NMR Solvent |
| Uses | Recent uses include a gas-phase study of the silaformamide ion and an investigation of substituent effects in photosolvolysis. |
| General Description | 2,2,2-Trifluoroethanol-d3 (TFEd3) is 2,2,2-trifluoroethanol in which hydrogen of the –OH group is substituted with deuterium. It is a commonly used 1H NMR and 13C NMR solvent. |
