Introduction：Basic information about 2,2',3,3',4,4'-HEXACHLOROBIPHENYL CAS 38380-07-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 2,2',3,3',4,4'-HEXACHLOROBIPHENYL Basic information
- 2. 2,2',3,3',4,4'-HEXACHLOROBIPHENYL Chemical Properties
- 3. Safety Information
- 4. 2,2',3,3',4,4'-HEXACHLOROBIPHENYL Usage And Synthesis
- 5. 2,2',3,3',4,4'-HEXACHLOROBIPHENYL Preparation Products And Raw materials
2,2',3,3',4,4'-HEXACHLOROBIPHENYL Basic information
| Product Name: | 2,2',3,3',4,4'-HEXACHLOROBIPHENYL |
| Synonyms: | 2,3,4,2',3',4'-Hexachlorobiphenyl;2,3,4,2’,3’,4’-hexachlorobiphenyl;pcb128;PCB-128;1,1'-BIPHENYL,2,2',3,3',4,;Inchi=1/C12H4cl6/C13-7-3-1-5(9(15)11(7)17)6-2-4-8(14)12(18)10(6)16/H1-4;2,2',3,3',4,4'-HEXACHLOROBIPHENYL;2.2'.3.3'.4.4'-Hexachlorobiphenyl 20mg [38380-07-3] |
| CAS: | 38380-07-3 |
| MF: | C12H4Cl6 |
| MW: | 360.88 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 38380-07-3.mol |
|
2,2',3,3',4,4'-HEXACHLOROBIPHENYL Chemical Properties
| Melting point | 151°C |
| Boiling point | 446.99°C (rough estimate) |
| density | 1.5940 (rough estimate) |
| refractive index | 1.6270 (rough estimate) |
| storage temp. | room temp |
| solubility | Acetonitrile (Slightly, Heated, Sonicated), Chloroform (Slightly), Ethyl Acetate |
| form | Solid |
| color | White to Pale Beige |
| Water Solubility | 0.3497ug/L(25 ºC) |
| CAS DataBase Reference | 38380-07-3 |
| EPA Substance Registry System | 2,2',3,3',4,4'-Hexachlorobiphenyl (38380-07-3) |
Safety Information
| Hazard Codes | N |
| Risk Statements | 33-50/53 |
| Safety Statements | 60-61 |
2,2',3,3',4,4'-HEXACHLOROBIPHENYL Usage And Synthesis
| Uses | 2,2'',3,3'',4,4''-Hexachlorobiphenyl is a polychlorinated biphenyl (PCB) found in air, soil, mammals, and marine animals. |
2,2',3,3',4,4'-HEXACHLOROBIPHENYL Preparation Products And Raw materials
