Introduction：Basic information about 2,2,6,6-Tetramethyl-3,5-heptanedione CAS 1118-71-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 2,2,6,6-Tetramethyl-3,5-heptanedione Basic information
- 2. 2,2,6,6-Tetramethyl-3,5-heptanedione Chemical Properties
- 3. Safety Information
- 4. 2,2,6,6-Tetramethyl-3,5-heptanedione Usage And Synthesis
- 5. 2,2,6,6-Tetramethyl-3,5-heptanedione Preparation Products And Raw materials
2,2,6,6-Tetramethyl-3,5-heptanedione Basic information
| Product Name: | 2,2,6,6-Tetramethyl-3,5-heptanedione |
| Synonyms: | (CH3)3CCOCH2COC(CH3)3;2,2,6,6-Tetramethyl heptanedione;2,2,6,6-tetramethyl-5-heptanedione;TMHD;DIPIVALOYLMETHANE;2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONE DIPIVALOYLMETHANE;2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONE;2,2,6,6-TETRAMETHYLHEPTANE-3,5-DIONE |
| CAS: | 1118-71-4 |
| MF: | C11H20O2 |
| MW: | 184.28 |
| EINECS: | 214-268-3 |
| Product Categories: | Achiral Oxygen;organic compound;Environmentally-friendly Oxidation;Ligands (Environmentally-friendly Oxidation);Synthetic Organic Chemistry;CHIRAL CHEMICALS |
| Mol File: | 1118-71-4.mol |
|
2,2,6,6-Tetramethyl-3,5-heptanedione Chemical Properties
| Melting point | >400 °C (decomp) |
| Boiling point | 72-73 °C/6 mmHg (lit.) |
| density | 0.883 g/mL at 25 °C (lit.) |
| refractive index | n20/D 1.459(lit.) |
| Fp | 153 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Difficult to mix. |
| pka | 11.60±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Specific Gravity | 0.883 |
| BRN | 1447269 |
| InChI | 1S/C11H20O2/c1-10(2,3)8(12)7-9(13)11(4,5)6/h7H2,1-6H3 |
| InChIKey | YRAJNWYBUCUFBD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)C |
| LogP | 2.818 (est) |
| CAS DataBase Reference | 1118-71-4(CAS DataBase Reference) |
| EPA Substance Registry System | 3,5-Heptanedione, 2,2,6,6-tetramethyl- (1118-71-4) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-40-36/37/38 |
| Safety Statements | 24/25-36-26-22 |
| RIDADR | UN 1993 / PGIII |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29141900 |
| Storage Class | 10 - Combustible liquids |
2,2,6,6-Tetramethyl-3,5-heptanedione Usage And Synthesis
| Chemical Properties | CLEAR COLOURLESS TO SLIGHTLY YELLOW LIQUID |
| Uses | suzuki reaction |
| Uses | 2,2,6,6-tetramethyl-3,5-heptanedione was used in the synthesis of α-aryl-β-diketones1 and dicyanamidobenzene-bridge diruthenium complex. |
| Uses | 2,2,6,6-Tetramethyl-3,5-heptanedione is a beta diketone with antibacterial activity. |
| Definition | 2,2,6,6-Tetramethyl-3,5-heptanedioneis a stable, anhydrous reagent. It undergoes O-additions and C-additions. In various reactions, it acts as an air-stable ligand for metal catalysts. Furthermore, it serves as a substrate for heterocycles. |
| Synthesis Reference(s) | Journal of the American Chemical Society, 100, p. 5428, 1978 DOI: 10.1021/ja00485a030 |
| General Description | Acylation, a replacement to silylation, allows the conversion of compounds that consist of active hydrogens (-OH, -SH and -NH) into esters, thioesters, and amides via the action of a carboxylic acid or derivative. The carbonyl group adjacent to the halogenated carbons is known to improve the electron capture detector (ECD) response. Acylation has several advantages:
- It enhances the stability of compounds by protecting unstable groups.
- It may confer volatility on substances like carbohydrates or amino acids, that have several polar groups that they are non-volatile and usually decompose on heating.
- It facilitates the separations not possible with underivatized compounds.
- Compounds are detectable at very low levels with an ECD.
2,2,6,6-Tetramethyl-3,5-heptanedione is a reagent used to form fragmentation-directing derivatives for GC/MS analysis. |
| reaction suitability | reagent type: derivatization reagent
reaction type: Acylations |
| Synthesis | Methyl pivalate and formamide could be used as starting materials to synthesize 2,2,6,6-Tetramethyl-3,5-heptanedione.
|
2,2,6,6-Tetramethyl-3,5-heptanedione Preparation Products And Raw materials
| Raw materials | Ethanol-->Hydrochloric acid-->Ethyl acetate-->Diethyl ether-->Tetrahydrofuran-->N,N-Dimethylformamide-->Sodium hydride-->Pinacolone-->Methyl trimethylacetate-->4-Heptyn-3-one, 2,2,6,6-tetramethyl--->Benzenemethanamine, N-(1,2,2-trimethylpropylidene)--->Dipivaloylamine-->2,2-Dimethylpropanoic acid phenyl ester-->Propanamide,2,2-dimethyl-N-(phenylmethyl)--->2,3,3-TRIMETHYL-2-BUTANOL-->8-Hydroxyquinoline |
| Preparation Products | N,N-DIPHENYLQUINACRIDONE-->2,2,6,6-TETRAMETHYL-3,5-HEPTANEDIONATO POTASSIUM-->3,5-Heptanedione, 4-bromo-2,2,6,6-tetramethyl- |
