Introduction：Basic information about 2,2',6,6'-Tetramethyl-4,4'-biphenol CAS 2417-04-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 2,2',6,6'-Tetramethyl-4,4'-biphenol Basic information
- 2. 2,2',6,6'-Tetramethyl-4,4'-biphenol Chemical Properties
- 3. Safety Information
- 4. 2,2',6,6'-Tetramethyl-4,4'-biphenol Usage And Synthesis
- 5. 2,2',6,6'-Tetramethyl-4,4'-biphenol Preparation Products And Raw materials
2,2',6,6'-Tetramethyl-4,4'-biphenol Basic information
| Product Name: | 2,2',6,6'-Tetramethyl-4,4'-biphenol |
| Synonyms: | TMDHB;1’-biphenyl]-4,4’-diol,3,3’,5,5’-tetramethyl-[;4-(4-Hydroxy-3,5-dimethyl-phenyl)-2,6-dimethyl-phenol;2,2',6,6'-tetramethyl-4,4'-biphenol;2,2',6,6'-Tetramethylbiphenol;4,4'-Bi(2,6-dimethylphenol);3,3',5,5'-TETRAMETHYL [1,1'-BIPHENYL] 4,4'-DIOL;3,3',5,5'-TETRAMETHYL-4,4'-DIHYDROXYBIPHENYL |
| CAS: | 2417-04-1 |
| MF: | C16H18O2 |
| MW: | 242.31 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 2417-04-1.mol |
|
2,2',6,6'-Tetramethyl-4,4'-biphenol Chemical Properties
| Melting point | 222-225 °C(lit.) |
| Boiling point | 345.14°C (rough estimate) |
| density | 1.0537 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 10.22±0.40(Predicted) |
| form | Solid |
| color | Pale Beige to Light Beige |
| InChI | InChI=1S/C16H18O2/c1-9-5-13(6-10(2)15(9)17)14-7-11(3)16(18)12(4)8-14/h5-8,17-18H,1-4H3 |
| InChIKey | YGYPMFPGZQPETF-UHFFFAOYSA-N |
| SMILES | C1(C2=CC(C)=C(O)C(C)=C2)=CC(C)=C(O)C(C)=C1 |
| CAS DataBase Reference | 2417-04-1(CAS DataBase Reference) |
| EPA Substance Registry System | [1,1'-Biphenyl]-4,4'-diol, 3,3',5,5'-tetramethyl- (2417-04-1) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36-22 |
| TSCA | TSCA listed |
| HS Code | 2907.29.9000 |
2,2',6,6'-Tetramethyl-4,4'-biphenol Usage And Synthesis
| Uses | 2,2',6,6'-tetramethyl-4,4'-biphenol is used for the synthesis of liquid crystal polymer, the synthetic polymer material having a high strength, high modulus, excellent dimensional stability and used widely in various fields. |
| Uses | 3,3'',5,5''-Tetramethyl[1,1''-biphenyl]-4,4''-diol, is a building block used in chemical synthesis of Mexiletine (M340800) and it’s derivatives. |
2,2',6,6'-Tetramethyl-4,4'-biphenol Preparation Products And Raw materials
