2,2-Bis(4-aminophenyl)hexafluoropropane CAS 1095-78-9
Introduction：Basic information about 2,2-Bis(4-aminophenyl)hexafluoropropane CAS 1095-78-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,2-Bis(4-aminophenyl)hexafluoropropane Basic information
| Product Name: | 2,2-Bis(4-aminophenyl)hexafluoropropane |
| Synonyms: | 6F-DIAMINE;2,2-Bis(4-aminophenyl)-1,1,1,3,3,3-hexafluoropropane;4,4'-(1,1,1,3,3,3-Hexafluoropropane-2,2-diyl)bisaniline;4,4'-(1,1,1,3,3,3-Hexafluoropropane-2,2-diyl)dianiline;4,4'-(1-Trifluoromethyl-2,2,2-trifluoroethylidene)bisaniline;4,4'-(Hexafluoroisopropylidene)bis(benzenamine);4,4'-(Hexafluoroisopropylidene)dianiline,98%;2,2-Bis(4-aminophenyl)hexafluoropropane 98% |
| CAS: | 1095-78-9 |
| MF: | C15H12F6N2 |
| MW: | 334.26 |
| EINECS: | 206-141-6 |
| Product Categories: | Bisphenol AF type Compounds (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;Amine Monomers;Monomers;Primary Amines;monomer;1095-78-9 |
| Mol File: | 1095-78-9.mol |
2,2-Bis(4-aminophenyl)hexafluoropropane Chemical Properties
| Melting point | 195-198 °C(lit.) |
| Boiling point | 351.2±42.0 °C(Predicted) |
| density | 1.3410 (estimate) |
| storage temp. | 2-8°C, protect from light |
| solubility | Soluble in Methanol |
| form | Crystalline Powder |
| pka | 3.98±0.25(Predicted) |
| color | White to light yellow |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C15H12F6N2/c16-14(17,18)13(15(19,20)21,9-1-5-11(22)6-2-9)10-3-7-12(23)8-4-10/h1-8H,22-23H2 |
| InChIKey | BEKFRNOZJSYWKZ-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(N)C=C1)(C1=CC=C(N)C=C1)(C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 1095-78-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis- (1095-78-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29215900 |
| Storage Class | 11 - Combustible Solids |
| Description | 2,2-Bis(4-aminophenyl)hexafluoropropane is a fluorinated organic monomer compound used in the synthesis of a wide variety of polymers and their derivatives, such as polyimides and polyamides. Polyhydroxylamides are used as carriers for thin film composite membranes for water treatment. |
| Chemical Properties | white crystalline powder |
| Uses | 2,2-Bis(4-aminophenyl)hexafluoropropane is used as a reactant in the crosslinking and stabilization of nanoparticle-filled polymethylpentyne nanocomposite membranes for gas separations. |
2,2-Bis(4-aminophenyl)hexafluoropropane Preparation Products And Raw materials
| Raw materials | Bisphenol AF |
